C22H26N2O6 — CID 7773052
[2-(5-methoxy-2-methyl-4-nitroanilino)-2-oxoethyl] (2R,3S)-3-methyl-2-phenylpentanoate (PubChem CID 7773052) has the molecular formula C22H26N2O6 and a molecular weight of 414.46 g/mol. Its IUPAC name is [2-(5-methoxy-2-methyl-4-nitroanilino)-2-oxoethyl] (2R,3S)-3-methyl-2-phenylpentanoate.
| Compound Name | [2-(5-methoxy-2-methyl-4-nitroanilino)-2-oxoethyl] (2R,3S)-3-methyl-2-phenylpentanoate |
|---|---|
| PubChem CID | 7773052 |
| Molecular Formula | C22H26N2O6 |
| Molecular Weight | 414.46 g/mol |
| Exact Mass | 414.18 |
| IUPAC Name | [2-(5-methoxy-2-methyl-4-nitroanilino)-2-oxoethyl] (2R,3S)-3-methyl-2-phenylpentanoate |
| SMILES | CC[C@H](C)[C@@H](C(=O)OCC(=O)Nc1cc(OC)c([N+](=O)[O-])cc1C)c1ccccc1 |
| InChI | InChI=1S/C22H26N2O6/c1-5-14(2)21(16-9-7-6-8-10-16)22(26)30-13-20(25)23-17-12-19(29-4)18(24(27)28)11-15(17)3/h6-12,14,21H,5,13H2,1-4H3,(H,23,25)/t14-,21+/m0/s1 |
| InChIKey | LVLCZBXOMUUKAU-LHSJRXKWSA-N |
| XLogP | 4.22 |
| TPSA | 107.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.46 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|