C15H19NO5S — CID 7773238
[2-(ethoxycarbonylamino)-2-oxoethyl] 2-[(4-methylphenyl)methylsulfanyl]acetate (PubChem CID 7773238) has the molecular formula C15H19NO5S and a molecular weight of 325.39 g/mol. Its IUPAC name is [2-(ethoxycarbonylamino)-2-oxoethyl] 2-[(4-methylphenyl)methylsulfanyl]acetate.
| Compound Name | [2-(ethoxycarbonylamino)-2-oxoethyl] 2-[(4-methylphenyl)methylsulfanyl]acetate |
|---|---|
| PubChem CID | 7773238 |
| Molecular Formula | C15H19NO5S |
| Molecular Weight | 325.39 g/mol |
| Exact Mass | 325.10 |
| IUPAC Name | [2-(ethoxycarbonylamino)-2-oxoethyl] 2-[(4-methylphenyl)methylsulfanyl]acetate |
| SMILES | CCOC(=O)NC(=O)COC(=O)CSCc1ccc(C)cc1 |
| InChI | InChI=1S/C15H19NO5S/c1-3-20-15(19)16-13(17)8-21-14(18)10-22-9-12-6-4-11(2)5-7-12/h4-7H,3,8-10H2,1-2H3,(H,16,17,19) |
| InChIKey | ABZCUNAIDHSCBO-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.39 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |