C21H28N4O2 — CID 7775025
2-[(2S)-2-(1-methylpyrrol-2-yl)pyrrolidin-1-yl]-N-(2-morpholin-4-ylphenyl)acetamide (PubChem CID 7775025) has the molecular formula C21H28N4O2 and a molecular weight of 368.48 g/mol. Its IUPAC name is 2-[(2S)-2-(1-methylpyrrol-2-yl)pyrrolidin-1-yl]-N-(2-morpholin-4-ylphenyl)acetamide.
| Compound Name | 2-[(2S)-2-(1-methylpyrrol-2-yl)pyrrolidin-1-yl]-N-(2-morpholin-4-ylphenyl)acetamide |
|---|---|
| PubChem CID | 7775025 |
| Molecular Formula | C21H28N4O2 |
| Molecular Weight | 368.48 g/mol |
| Exact Mass | 368.22 |
| IUPAC Name | 2-[(2S)-2-(1-methylpyrrol-2-yl)pyrrolidin-1-yl]-N-(2-morpholin-4-ylphenyl)acetamide |
| SMILES | Cn1cccc1[C@@H]1CCCN1CC(=O)Nc1ccccc1N1CCOCC1 |
| InChI | InChI=1S/C21H28N4O2/c1-23-10-4-8-19(23)20-9-5-11-25(20)16-21(26)22-17-6-2-3-7-18(17)24-12-14-27-15-13-24/h2-4,6-8,10,20H,5,9,11-16H2,1H3,(H,22,26)/t20-/m0/s1 |
| InChIKey | WKRSKOLXRTVNHO-FQEVSTJZSA-N |
| XLogP | 2.64 |
| TPSA | 49.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.48 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |