About 1-ethylsulfonyl-4-[(1R,2S)-2-methylcyclohexyl]piperazine
1-ethylsulfonyl-4-[(1R,2S)-2-methylcyclohexyl]piperazine (PubChem CID 777507) has the molecular formula C13H26N2O2S
and a molecular weight of 274.43 g/mol. Its IUPAC name is 1-ethylsulfonyl-4-[(1R,2S)-2-methylcyclohexyl]piperazine.
Molecular Properties
| Compound Name | 1-ethylsulfonyl-4-[(1R,2S)-2-methylcyclohexyl]piperazine |
| PubChem CID | 777507 |
| Molecular Formula | C13H26N2O2S |
| Molecular Weight | 274.43 g/mol |
| Exact Mass | 274.17 |
| IUPAC Name | 1-ethylsulfonyl-4-[(1R,2S)-2-methylcyclohexyl]piperazine |
| SMILES | CCS(=O)(=O)N1CCN([C@@H]2CCCC[C@@H]2C)CC1 |
| InChI | InChI=1S/C13H26N2O2S/c1-3-18(16,17)15-10-8-14(9-11-15)13-7-5-4-6-12(13)2/h12-13H,3-11H2,1-2H3/t12-,13+/m0/s1 |
| InChIKey | OBHKVFLZCBWBCG-QWHCGFSZSA-N |
| XLogP | 1.53 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 274.43 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-ethylsulfonyl-4-[(1R,2S)-2-methylcyclohexyl]piperazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-ethylsulfonyl-4-[(1R,2S)-2-methylcyclohexyl]piperazine?
The IUPAC name of 1-ethylsulfonyl-4-[(1R,2S)-2-methylcyclohexyl]piperazine (CID 777507) is 1-ethylsulfonyl-4-[(1R,2S)-2-methylcyclohexyl]piperazine.
What is the SMILES notation for 1-ethylsulfonyl-4-[(1R,2S)-2-methylcyclohexyl]piperazine?
The canonical SMILES for 1-ethylsulfonyl-4-[(1R,2S)-2-methylcyclohexyl]piperazine is CCS(=O)(=O)N1CCN([C@@H]2CCCC[C@@H]2C)CC1.
What is the InChIKey of 1-ethylsulfonyl-4-[(1R,2S)-2-methylcyclohexyl]piperazine?
The InChIKey is OBHKVFLZCBWBCG-QWHCGFSZSA-N. The full InChI is InChI=1S/C13H26N2O2S/c1-3-18(16,17)15-10-8-14(9-11-15)13-7-5-4-6-12(13)2/h12-13H,3-11H2,1-2H3/t12-,13+/m0/s1.
What are the key properties of 1-ethylsulfonyl-4-[(1R,2S)-2-methylcyclohexyl]piperazine?
1-ethylsulfonyl-4-[(1R,2S)-2-methylcyclohexyl]piperazine has a molecular weight of 274.43 g/mol, XLogP of 1.53, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-ethylsulfonyl-4-[(1R,2S)-2-methylcyclohexyl]piperazine is sourced from PubChem (CID 777507), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).