C15H9F3N2O2 — CID 777559
N-[3-(1,3-benzoxazol-2-yl)phenyl]-2,2,2-trifluoroacetamide (PubChem CID 777559) has the molecular formula C15H9F3N2O2 and a molecular weight of 306.24 g/mol. Its IUPAC name is N-[3-(1,3-benzoxazol-2-yl)phenyl]-2,2,2-trifluoroacetamide.
| Compound Name | N-[3-(1,3-benzoxazol-2-yl)phenyl]-2,2,2-trifluoroacetamide |
|---|---|
| PubChem CID | 777559 |
| Molecular Formula | C15H9F3N2O2 |
| Molecular Weight | 306.24 g/mol |
| Exact Mass | 306.06 |
| IUPAC Name | N-[3-(1,3-benzoxazol-2-yl)phenyl]-2,2,2-trifluoroacetamide |
| SMILES | O=C(Nc1cccc(-c2nc3ccccc3o2)c1)C(F)(F)F |
| InChI | InChI=1S/C15H9F3N2O2/c16-15(17,18)14(21)19-10-5-3-4-9(8-10)13-20-11-6-1-2-7-12(11)22-13/h1-8H,(H,19,21) |
| InChIKey | WSPGVNXKHNEGGH-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 55.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.24 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |