About [2-[(3-carbamoylthiophen-2-yl)amino]-2-oxoethyl] pyridine-2-carboxylate
[2-[(3-carbamoylthiophen-2-yl)amino]-2-oxoethyl] pyridine-2-carboxylate (PubChem CID 7776268) has the molecular formula C13H11N3O4S
and a molecular weight of 305.31 g/mol. Its IUPAC name is [2-[(3-carbamoylthiophen-2-yl)amino]-2-oxoethyl] pyridine-2-carboxylate.
Molecular Properties
| Compound Name | [2-[(3-carbamoylthiophen-2-yl)amino]-2-oxoethyl] pyridine-2-carboxylate |
| PubChem CID | 7776268 |
| Molecular Formula | C13H11N3O4S |
| Molecular Weight | 305.31 g/mol |
| Exact Mass | 305.05 |
| IUPAC Name | [2-[(3-carbamoylthiophen-2-yl)amino]-2-oxoethyl] pyridine-2-carboxylate |
| SMILES | NC(=O)c1ccsc1NC(=O)COC(=O)c1ccccn1 |
| InChI | InChI=1S/C13H11N3O4S/c14-11(18)8-4-6-21-12(8)16-10(17)7-20-13(19)9-3-1-2-5-15-9/h1-6H,7H2,(H2,14,18)(H,16,17) |
| InChIKey | JJNQQBYGGSEEDS-UHFFFAOYSA-N |
| XLogP | 1.04 |
| TPSA | 111.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 305.31 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze [2-[(3-carbamoylthiophen-2-yl)amino]-2-oxoethyl] pyridine-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-[(3-carbamoylthiophen-2-yl)amino]-2-oxoethyl] pyridine-2-carboxylate?
The IUPAC name of [2-[(3-carbamoylthiophen-2-yl)amino]-2-oxoethyl] pyridine-2-carboxylate (CID 7776268) is [2-[(3-carbamoylthiophen-2-yl)amino]-2-oxoethyl] pyridine-2-carboxylate.
What is the SMILES notation for [2-[(3-carbamoylthiophen-2-yl)amino]-2-oxoethyl] pyridine-2-carboxylate?
The canonical SMILES for [2-[(3-carbamoylthiophen-2-yl)amino]-2-oxoethyl] pyridine-2-carboxylate is NC(=O)c1ccsc1NC(=O)COC(=O)c1ccccn1.
What is the InChIKey of [2-[(3-carbamoylthiophen-2-yl)amino]-2-oxoethyl] pyridine-2-carboxylate?
The InChIKey is JJNQQBYGGSEEDS-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H11N3O4S/c14-11(18)8-4-6-21-12(8)16-10(17)7-20-13(19)9-3-1-2-5-15-9/h1-6H,7H2,(H2,14,18)(H,16,17).
What are the key properties of [2-[(3-carbamoylthiophen-2-yl)amino]-2-oxoethyl] pyridine-2-carboxylate?
[2-[(3-carbamoylthiophen-2-yl)amino]-2-oxoethyl] pyridine-2-carboxylate has a molecular weight of 305.31 g/mol, XLogP of 1.04, 5 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [2-[(3-carbamoylthiophen-2-yl)amino]-2-oxoethyl] pyridine-2-carboxylate is sourced from PubChem (CID 7776268), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).