About 4-bromo-N-(4-hydroxy-2,5-dimethylphenyl)benzamide
4-bromo-N-(4-hydroxy-2,5-dimethylphenyl)benzamide (PubChem CID 777679) has the molecular formula C15H14BrNO2
and a molecular weight of 320.19 g/mol. Its IUPAC name is 4-bromo-N-(4-hydroxy-2,5-dimethylphenyl)benzamide.
Molecular Properties
| Compound Name | 4-bromo-N-(4-hydroxy-2,5-dimethylphenyl)benzamide |
| PubChem CID | 777679 |
| Molecular Formula | C15H14BrNO2 |
| Molecular Weight | 320.19 g/mol |
| Exact Mass | 319.02 |
| IUPAC Name | 4-bromo-N-(4-hydroxy-2,5-dimethylphenyl)benzamide |
| SMILES | Cc1cc(NC(=O)c2ccc(Br)cc2)c(C)cc1O |
| InChI | InChI=1S/C15H14BrNO2/c1-9-8-14(18)10(2)7-13(9)17-15(19)11-3-5-12(16)6-4-11/h3-8,18H,1-2H3,(H,17,19) |
| InChIKey | CMUZXRNYZHMNLA-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 320.19 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|
Analyze 4-bromo-N-(4-hydroxy-2,5-dimethylphenyl)benzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-bromo-N-(4-hydroxy-2,5-dimethylphenyl)benzamide?
The IUPAC name of 4-bromo-N-(4-hydroxy-2,5-dimethylphenyl)benzamide (CID 777679) is 4-bromo-N-(4-hydroxy-2,5-dimethylphenyl)benzamide.
What is the SMILES notation for 4-bromo-N-(4-hydroxy-2,5-dimethylphenyl)benzamide?
The canonical SMILES for 4-bromo-N-(4-hydroxy-2,5-dimethylphenyl)benzamide is Cc1cc(NC(=O)c2ccc(Br)cc2)c(C)cc1O.
What is the InChIKey of 4-bromo-N-(4-hydroxy-2,5-dimethylphenyl)benzamide?
The InChIKey is CMUZXRNYZHMNLA-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H14BrNO2/c1-9-8-14(18)10(2)7-13(9)17-15(19)11-3-5-12(16)6-4-11/h3-8,18H,1-2H3,(H,17,19).
What are the key properties of 4-bromo-N-(4-hydroxy-2,5-dimethylphenyl)benzamide?
4-bromo-N-(4-hydroxy-2,5-dimethylphenyl)benzamide has a molecular weight of 320.19 g/mol, XLogP of 4.02, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-bromo-N-(4-hydroxy-2,5-dimethylphenyl)benzamide is sourced from PubChem (CID 777679), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).