C21H18O3 — CID 7779040
[2-(9H-fluoren-3-yl)-2-oxoethyl] (2E,4E)-hexa-2,4-dienoate (PubChem CID 7779040) has the molecular formula C21H18O3 and a molecular weight of 318.37 g/mol. Its IUPAC name is [2-(9H-fluoren-3-yl)-2-oxoethyl] (2E,4E)-hexa-2,4-dienoate.
| Compound Name | [2-(9H-fluoren-3-yl)-2-oxoethyl] (2E,4E)-hexa-2,4-dienoate |
|---|---|
| PubChem CID | 7779040 |
| Molecular Formula | C21H18O3 |
| Molecular Weight | 318.37 g/mol |
| Exact Mass | 318.13 |
| IUPAC Name | [2-(9H-fluoren-3-yl)-2-oxoethyl] (2E,4E)-hexa-2,4-dienoate |
| SMILES | C/C=C/C=C/C(=O)OCC(=O)c1ccc2c(c1)-c1ccccc1C2 |
| InChI | InChI=1S/C21H18O3/c1-2-3-4-9-21(23)24-14-20(22)17-11-10-16-12-15-7-5-6-8-18(15)19(16)13-17/h2-11,13H,12,14H2,1H3/b3-2+,9-4+ |
| InChIKey | CSNMPDABKWWCGU-DSXPNFDZSA-N |
| XLogP | 4.12 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.37 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|