C17H18ClN3O3S2 — CID 7779532
N-(3-chlorophenyl)-2-[(5-pyrrolidin-1-ylsulfonyl-2-pyridinyl)sulfanyl]acetamide (PubChem CID 7779532) has the molecular formula C17H18ClN3O3S2 and a molecular weight of 411.94 g/mol. Its IUPAC name is N-(3-chlorophenyl)-2-[(5-pyrrolidin-1-ylsulfonyl-2-pyridinyl)sulfanyl]acetamide.
| Compound Name | N-(3-chlorophenyl)-2-[(5-pyrrolidin-1-ylsulfonyl-2-pyridinyl)sulfanyl]acetamide |
|---|---|
| PubChem CID | 7779532 |
| Molecular Formula | C17H18ClN3O3S2 |
| Molecular Weight | 411.94 g/mol |
| Exact Mass | 411.05 |
| IUPAC Name | N-(3-chlorophenyl)-2-[(5-pyrrolidin-1-ylsulfonyl-2-pyridinyl)sulfanyl]acetamide |
| SMILES | O=C(CSc1ccc(S(=O)(=O)N2CCCC2)cn1)Nc1cccc(Cl)c1 |
| InChI | InChI=1S/C17H18ClN3O3S2/c18-13-4-3-5-14(10-13)20-16(22)12-25-17-7-6-15(11-19-17)26(23,24)21-8-1-2-9-21/h3-7,10-11H,1-2,8-9,12H2,(H,20,22) |
| InChIKey | AGMLYYAADRFIPZ-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 79.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.94 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |