C22H22N2O2S2 — CID 7780066
2-[methyl-(2-naphthalen-2-ylsulfanylacetyl)amino]-N-(2-methylsulfanylphenyl)acetamide (PubChem CID 7780066) has the molecular formula C22H22N2O2S2 and a molecular weight of 410.56 g/mol. Its IUPAC name is 2-[methyl-(2-naphthalen-2-ylsulfanylacetyl)amino]-N-(2-methylsulfanylphenyl)acetamide.
| Compound Name | 2-[methyl-(2-naphthalen-2-ylsulfanylacetyl)amino]-N-(2-methylsulfanylphenyl)acetamide |
|---|---|
| PubChem CID | 7780066 |
| Molecular Formula | C22H22N2O2S2 |
| Molecular Weight | 410.56 g/mol |
| Exact Mass | 410.11 |
| IUPAC Name | 2-[methyl-(2-naphthalen-2-ylsulfanylacetyl)amino]-N-(2-methylsulfanylphenyl)acetamide |
| SMILES | CSc1ccccc1NC(=O)CN(C)C(=O)CSc1ccc2ccccc2c1 |
| InChI | InChI=1S/C22H22N2O2S2/c1-24(14-21(25)23-19-9-5-6-10-20(19)27-2)22(26)15-28-18-12-11-16-7-3-4-8-17(16)13-18/h3-13H,14-15H2,1-2H3,(H,23,25) |
| InChIKey | NQNZKVRTBUEZLD-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.56 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |