C14H18N2O5S — CID 7780940
[2-[[(3S)-3-methyl-1,1-dioxothiolan-3-yl]amino]-2-oxoethyl] 4-aminobenzoate (PubChem CID 7780940) has the molecular formula C14H18N2O5S and a molecular weight of 326.37 g/mol. Its IUPAC name is [2-[[(3S)-3-methyl-1,1-dioxothiolan-3-yl]amino]-2-oxoethyl] 4-aminobenzoate.
| Compound Name | [2-[[(3S)-3-methyl-1,1-dioxothiolan-3-yl]amino]-2-oxoethyl] 4-aminobenzoate |
|---|---|
| PubChem CID | 7780940 |
| Molecular Formula | C14H18N2O5S |
| Molecular Weight | 326.37 g/mol |
| Exact Mass | 326.09 |
| IUPAC Name | [2-[[(3S)-3-methyl-1,1-dioxothiolan-3-yl]amino]-2-oxoethyl] 4-aminobenzoate |
| SMILES | C[C@]1(NC(=O)COC(=O)c2ccc(N)cc2)CCS(=O)(=O)C1 |
| InChI | InChI=1S/C14H18N2O5S/c1-14(6-7-22(19,20)9-14)16-12(17)8-21-13(18)10-2-4-11(15)5-3-10/h2-5H,6-9,15H2,1H3,(H,16,17)/t14-/m0/s1 |
| InChIKey | MMTGYKQXWMWINA-AWEZNQCLSA-N |
| XLogP | 0.12 |
| TPSA | 115.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.37 |
| LogP ≤ 5 | 0.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|