About (5-oxo-[1,3]thiazolo[3,2-a]pyrimidin-7-yl)methyl 2-methylpropanoate
(5-oxo-[1,3]thiazolo[3,2-a]pyrimidin-7-yl)methyl 2-methylpropanoate (PubChem CID 7782367) has the molecular formula C11H12N2O3S
and a molecular weight of 252.29 g/mol. Its IUPAC name is (5-oxo-[1,3]thiazolo[3,2-a]pyrimidin-7-yl)methyl 2-methylpropanoate.
Molecular Properties
| Compound Name | (5-oxo-[1,3]thiazolo[3,2-a]pyrimidin-7-yl)methyl 2-methylpropanoate |
| PubChem CID | 7782367 |
| Molecular Formula | C11H12N2O3S |
| Molecular Weight | 252.29 g/mol |
| Exact Mass | 252.06 |
| IUPAC Name | (5-oxo-[1,3]thiazolo[3,2-a]pyrimidin-7-yl)methyl 2-methylpropanoate |
| SMILES | CC(C)C(=O)OCc1cc(=O)n2ccsc2n1 |
| InChI | InChI=1S/C11H12N2O3S/c1-7(2)10(15)16-6-8-5-9(14)13-3-4-17-11(13)12-8/h3-5,7H,6H2,1-2H3 |
| InChIKey | YVLMIMIKSNRCKT-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 60.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 252.29 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze (5-oxo-[1,3]thiazolo[3,2-a]pyrimidin-7-yl)methyl 2-methylpropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5-oxo-[1,3]thiazolo[3,2-a]pyrimidin-7-yl)methyl 2-methylpropanoate?
The IUPAC name of (5-oxo-[1,3]thiazolo[3,2-a]pyrimidin-7-yl)methyl 2-methylpropanoate (CID 7782367) is (5-oxo-[1,3]thiazolo[3,2-a]pyrimidin-7-yl)methyl 2-methylpropanoate.
What is the SMILES notation for (5-oxo-[1,3]thiazolo[3,2-a]pyrimidin-7-yl)methyl 2-methylpropanoate?
The canonical SMILES for (5-oxo-[1,3]thiazolo[3,2-a]pyrimidin-7-yl)methyl 2-methylpropanoate is CC(C)C(=O)OCc1cc(=O)n2ccsc2n1.
What is the InChIKey of (5-oxo-[1,3]thiazolo[3,2-a]pyrimidin-7-yl)methyl 2-methylpropanoate?
The InChIKey is YVLMIMIKSNRCKT-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H12N2O3S/c1-7(2)10(15)16-6-8-5-9(14)13-3-4-17-11(13)12-8/h3-5,7H,6H2,1-2H3.
What are the key properties of (5-oxo-[1,3]thiazolo[3,2-a]pyrimidin-7-yl)methyl 2-methylpropanoate?
(5-oxo-[1,3]thiazolo[3,2-a]pyrimidin-7-yl)methyl 2-methylpropanoate has a molecular weight of 252.29 g/mol, XLogP of 1.46, 3 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for (5-oxo-[1,3]thiazolo[3,2-a]pyrimidin-7-yl)methyl 2-methylpropanoate is sourced from PubChem (CID 7782367), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).