About butyl (2R)-2-methyl-1,3-oxazolidine-3-carbodithioate
butyl (2R)-2-methyl-1,3-oxazolidine-3-carbodithioate (PubChem CID 7782568) has the molecular formula C9H17NOS2
and a molecular weight of 219.37 g/mol. Its IUPAC name is butyl (2R)-2-methyl-1,3-oxazolidine-3-carbodithioate.
Molecular Properties
| Compound Name | butyl (2R)-2-methyl-1,3-oxazolidine-3-carbodithioate |
| PubChem CID | 7782568 |
| Molecular Formula | C9H17NOS2 |
| Molecular Weight | 219.37 g/mol |
| Exact Mass | 219.08 |
| IUPAC Name | butyl (2R)-2-methyl-1,3-oxazolidine-3-carbodithioate |
| SMILES | CCCCSC(=S)N1CCO[C@@H]1C |
| InChI | InChI=1S/C9H17NOS2/c1-3-4-7-13-9(12)10-5-6-11-8(10)2/h8H,3-7H2,1-2H3/t8-/m1/s1 |
| InChIKey | BYEOIPZDNDAEJV-MRVPVSSYSA-N |
| XLogP | 2.48 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 219.37 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze butyl (2R)-2-methyl-1,3-oxazolidine-3-carbodithioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of butyl (2R)-2-methyl-1,3-oxazolidine-3-carbodithioate?
The IUPAC name of butyl (2R)-2-methyl-1,3-oxazolidine-3-carbodithioate (CID 7782568) is butyl (2R)-2-methyl-1,3-oxazolidine-3-carbodithioate.
What is the SMILES notation for butyl (2R)-2-methyl-1,3-oxazolidine-3-carbodithioate?
The canonical SMILES for butyl (2R)-2-methyl-1,3-oxazolidine-3-carbodithioate is CCCCSC(=S)N1CCO[C@@H]1C.
What is the InChIKey of butyl (2R)-2-methyl-1,3-oxazolidine-3-carbodithioate?
The InChIKey is BYEOIPZDNDAEJV-MRVPVSSYSA-N. The full InChI is InChI=1S/C9H17NOS2/c1-3-4-7-13-9(12)10-5-6-11-8(10)2/h8H,3-7H2,1-2H3/t8-/m1/s1.
What are the key properties of butyl (2R)-2-methyl-1,3-oxazolidine-3-carbodithioate?
butyl (2R)-2-methyl-1,3-oxazolidine-3-carbodithioate has a molecular weight of 219.37 g/mol, XLogP of 2.48, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for butyl (2R)-2-methyl-1,3-oxazolidine-3-carbodithioate is sourced from PubChem (CID 7782568), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).