About 1-(3,4-dimethoxyphenyl)sulfonylpyrrolidine
1-(3,4-dimethoxyphenyl)sulfonylpyrrolidine (PubChem CID 778310) has the molecular formula C12H17NO4S
and a molecular weight of 271.34 g/mol. Its IUPAC name is 1-(3,4-dimethoxyphenyl)sulfonylpyrrolidine.
Molecular Properties
| Compound Name | 1-(3,4-dimethoxyphenyl)sulfonylpyrrolidine |
| PubChem CID | 778310 |
| Molecular Formula | C12H17NO4S |
| Molecular Weight | 271.34 g/mol |
| Exact Mass | 271.09 |
| IUPAC Name | 1-(3,4-dimethoxyphenyl)sulfonylpyrrolidine |
| SMILES | COc1ccc(S(=O)(=O)N2CCCC2)cc1OC |
| InChI | InChI=1S/C12H17NO4S/c1-16-11-6-5-10(9-12(11)17-2)18(14,15)13-7-3-4-8-13/h5-6,9H,3-4,7-8H2,1-2H3 |
| InChIKey | VMGCIRQIOSUXBQ-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 271.34 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-(3,4-dimethoxyphenyl)sulfonylpyrrolidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(3,4-dimethoxyphenyl)sulfonylpyrrolidine?
The IUPAC name of 1-(3,4-dimethoxyphenyl)sulfonylpyrrolidine (CID 778310) is 1-(3,4-dimethoxyphenyl)sulfonylpyrrolidine.
What is the SMILES notation for 1-(3,4-dimethoxyphenyl)sulfonylpyrrolidine?
The canonical SMILES for 1-(3,4-dimethoxyphenyl)sulfonylpyrrolidine is COc1ccc(S(=O)(=O)N2CCCC2)cc1OC.
What is the InChIKey of 1-(3,4-dimethoxyphenyl)sulfonylpyrrolidine?
The InChIKey is VMGCIRQIOSUXBQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H17NO4S/c1-16-11-6-5-10(9-12(11)17-2)18(14,15)13-7-3-4-8-13/h5-6,9H,3-4,7-8H2,1-2H3.
What are the key properties of 1-(3,4-dimethoxyphenyl)sulfonylpyrrolidine?
1-(3,4-dimethoxyphenyl)sulfonylpyrrolidine has a molecular weight of 271.34 g/mol, XLogP of 1.49, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(3,4-dimethoxyphenyl)sulfonylpyrrolidine is sourced from PubChem (CID 778310), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).