About 4-bromo-3-methyl-1,2-benzothiazol-5-ol
4-bromo-3-methyl-1,2-benzothiazol-5-ol (PubChem CID 7784185) has the molecular formula C8H6BrNOS
and a molecular weight of 244.11 g/mol. Its IUPAC name is 4-bromo-3-methyl-1,2-benzothiazol-5-ol.
Molecular Properties
| Compound Name | 4-bromo-3-methyl-1,2-benzothiazol-5-ol |
| PubChem CID | 7784185 |
| Molecular Formula | C8H6BrNOS |
| Molecular Weight | 244.11 g/mol |
| Exact Mass | 242.94 |
| IUPAC Name | 4-bromo-3-methyl-1,2-benzothiazol-5-ol |
| SMILES | Cc1nsc2ccc(O)c(Br)c12 |
| InChI | InChI=1S/C8H6BrNOS/c1-4-7-6(12-10-4)3-2-5(11)8(7)9/h2-3,11H,1H3 |
| InChIKey | DVWHEKKUUHYCAH-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 33.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 244.11 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-bromo-3-methyl-1,2-benzothiazol-5-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-bromo-3-methyl-1,2-benzothiazol-5-ol?
The IUPAC name of 4-bromo-3-methyl-1,2-benzothiazol-5-ol (CID 7784185) is 4-bromo-3-methyl-1,2-benzothiazol-5-ol.
What is the SMILES notation for 4-bromo-3-methyl-1,2-benzothiazol-5-ol?
The canonical SMILES for 4-bromo-3-methyl-1,2-benzothiazol-5-ol is Cc1nsc2ccc(O)c(Br)c12.
What is the InChIKey of 4-bromo-3-methyl-1,2-benzothiazol-5-ol?
The InChIKey is DVWHEKKUUHYCAH-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H6BrNOS/c1-4-7-6(12-10-4)3-2-5(11)8(7)9/h2-3,11H,1H3.
What are the key properties of 4-bromo-3-methyl-1,2-benzothiazol-5-ol?
4-bromo-3-methyl-1,2-benzothiazol-5-ol has a molecular weight of 244.11 g/mol, XLogP of 3.07, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-bromo-3-methyl-1,2-benzothiazol-5-ol is sourced from PubChem (CID 7784185), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).