About (3-cyanophenyl)methyl 4-piperidin-1-ylsulfonylbenzoate
(3-cyanophenyl)methyl 4-piperidin-1-ylsulfonylbenzoate (PubChem CID 7784707) has the molecular formula C20H20N2O4S
and a molecular weight of 384.46 g/mol. Its IUPAC name is (3-cyanophenyl)methyl 4-piperidin-1-ylsulfonylbenzoate.
Molecular Properties
| Compound Name | (3-cyanophenyl)methyl 4-piperidin-1-ylsulfonylbenzoate |
| PubChem CID | 7784707 |
| Molecular Formula | C20H20N2O4S |
| Molecular Weight | 384.46 g/mol |
| Exact Mass | 384.11 |
| IUPAC Name | (3-cyanophenyl)methyl 4-piperidin-1-ylsulfonylbenzoate |
| SMILES | N#Cc1cccc(COC(=O)c2ccc(S(=O)(=O)N3CCCCC3)cc2)c1 |
| InChI | InChI=1S/C20H20N2O4S/c21-14-16-5-4-6-17(13-16)15-26-20(23)18-7-9-19(10-8-18)27(24,25)22-11-2-1-3-12-22/h4-10,13H,1-3,11-12,15H2 |
| InChIKey | FYENYECJYSNXMQ-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 87.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 384.46 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze (3-cyanophenyl)methyl 4-piperidin-1-ylsulfonylbenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3-cyanophenyl)methyl 4-piperidin-1-ylsulfonylbenzoate?
The IUPAC name of (3-cyanophenyl)methyl 4-piperidin-1-ylsulfonylbenzoate (CID 7784707) is (3-cyanophenyl)methyl 4-piperidin-1-ylsulfonylbenzoate.
What is the SMILES notation for (3-cyanophenyl)methyl 4-piperidin-1-ylsulfonylbenzoate?
The canonical SMILES for (3-cyanophenyl)methyl 4-piperidin-1-ylsulfonylbenzoate is N#Cc1cccc(COC(=O)c2ccc(S(=O)(=O)N3CCCCC3)cc2)c1.
What is the InChIKey of (3-cyanophenyl)methyl 4-piperidin-1-ylsulfonylbenzoate?
The InChIKey is FYENYECJYSNXMQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H20N2O4S/c21-14-16-5-4-6-17(13-16)15-26-20(23)18-7-9-19(10-8-18)27(24,25)22-11-2-1-3-12-22/h4-10,13H,1-3,11-12,15H2.
What are the key properties of (3-cyanophenyl)methyl 4-piperidin-1-ylsulfonylbenzoate?
(3-cyanophenyl)methyl 4-piperidin-1-ylsulfonylbenzoate has a molecular weight of 384.46 g/mol, XLogP of 3.09, 5 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (3-cyanophenyl)methyl 4-piperidin-1-ylsulfonylbenzoate is sourced from PubChem (CID 7784707), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).