C20H20N2O4S — CID 7784707
(3-cyanophenyl)methyl 4-piperidin-1-ylsulfonylbenzoate (PubChem CID 7784707) has the molecular formula C20H20N2O4S and a molecular weight of 384.46 g/mol. Its IUPAC name is (3-cyanophenyl)methyl 4-piperidin-1-ylsulfonylbenzoate.
| Compound Name | (3-cyanophenyl)methyl 4-piperidin-1-ylsulfonylbenzoate |
|---|---|
| PubChem CID | 7784707 |
| Molecular Formula | C20H20N2O4S |
| Molecular Weight | 384.46 g/mol |
| Exact Mass | 384.11 |
| IUPAC Name | (3-cyanophenyl)methyl 4-piperidin-1-ylsulfonylbenzoate |
| SMILES | N#Cc1cccc(COC(=O)c2ccc(S(=O)(=O)N3CCCCC3)cc2)c1 |
| InChI | InChI=1S/C20H20N2O4S/c21-14-16-5-4-6-17(13-16)15-26-20(23)18-7-9-19(10-8-18)27(24,25)22-11-2-1-3-12-22/h4-10,13H,1-3,11-12,15H2 |
| InChIKey | FYENYECJYSNXMQ-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 87.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.46 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |