C10H9Cl2N3S2 — CID 7785138
5-[2-(2,5-dichlorophenyl)sulfanylethylsulfanyl]-1H-1,2,4-triazole (PubChem CID 7785138) has the molecular formula C10H9Cl2N3S2 and a molecular weight of 306.24 g/mol. Its IUPAC name is 5-[2-(2,5-dichlorophenyl)sulfanylethylsulfanyl]-1H-1,2,4-triazole.
| Compound Name | 5-[2-(2,5-dichlorophenyl)sulfanylethylsulfanyl]-1H-1,2,4-triazole |
|---|---|
| PubChem CID | 7785138 |
| Molecular Formula | C10H9Cl2N3S2 |
| Molecular Weight | 306.24 g/mol |
| Exact Mass | 304.96 |
| IUPAC Name | 5-[2-(2,5-dichlorophenyl)sulfanylethylsulfanyl]-1H-1,2,4-triazole |
| SMILES | Clc1ccc(Cl)c(SCCSc2ncn[nH]2)c1 |
| InChI | InChI=1S/C10H9Cl2N3S2/c11-7-1-2-8(12)9(5-7)16-3-4-17-10-13-6-14-15-10/h1-2,5-6H,3-4H2,(H,13,14,15) |
| InChIKey | YKOMCEPBAYEOHC-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.24 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|