C20H20N2O6 — CID 7785859
[(2S)-1-[(2R)-2-methyl-2,3-dihydroindol-1-yl]-1-oxopropan-2-yl] 4-methoxy-3-nitrobenzoate (PubChem CID 7785859) has the molecular formula C20H20N2O6 and a molecular weight of 384.39 g/mol. Its IUPAC name is [(2S)-1-[(2R)-2-methyl-2,3-dihydroindol-1-yl]-1-oxopropan-2-yl] 4-methoxy-3-nitrobenzoate.
| Compound Name | [(2S)-1-[(2R)-2-methyl-2,3-dihydroindol-1-yl]-1-oxopropan-2-yl] 4-methoxy-3-nitrobenzoate |
|---|---|
| PubChem CID | 7785859 |
| Molecular Formula | C20H20N2O6 |
| Molecular Weight | 384.39 g/mol |
| Exact Mass | 384.13 |
| IUPAC Name | [(2S)-1-[(2R)-2-methyl-2,3-dihydroindol-1-yl]-1-oxopropan-2-yl] 4-methoxy-3-nitrobenzoate |
| SMILES | COc1ccc(C(=O)O[C@@H](C)C(=O)N2c3ccccc3C[C@H]2C)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C20H20N2O6/c1-12-10-14-6-4-5-7-16(14)21(12)19(23)13(2)28-20(24)15-8-9-18(27-3)17(11-15)22(25)26/h4-9,11-13H,10H2,1-3H3/t12-,13+/m1/s1 |
| InChIKey | MHGBHEVSRFOMBS-OLZOCXBDSA-N |
| XLogP | 3.13 |
| TPSA | 98.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.39 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|