C14H16N6OS — CID 7786223
(2S)-N-(2-cyanoethyl)-2-(1-methyltetrazol-5-yl)sulfanyl-N-phenylpropanamide (PubChem CID 7786223) has the molecular formula C14H16N6OS and a molecular weight of 316.39 g/mol. Its IUPAC name is (2S)-N-(2-cyanoethyl)-2-(1-methyltetrazol-5-yl)sulfanyl-N-phenylpropanamide.
| Compound Name | (2S)-N-(2-cyanoethyl)-2-(1-methyltetrazol-5-yl)sulfanyl-N-phenylpropanamide |
|---|---|
| PubChem CID | 7786223 |
| Molecular Formula | C14H16N6OS |
| Molecular Weight | 316.39 g/mol |
| Exact Mass | 316.11 |
| IUPAC Name | (2S)-N-(2-cyanoethyl)-2-(1-methyltetrazol-5-yl)sulfanyl-N-phenylpropanamide |
| SMILES | C[C@H](Sc1nnnn1C)C(=O)N(CCC#N)c1ccccc1 |
| InChI | InChI=1S/C14H16N6OS/c1-11(22-14-16-17-18-19(14)2)13(21)20(10-6-9-15)12-7-4-3-5-8-12/h3-5,7-8,11H,6,10H2,1-2H3/t11-/m0/s1 |
| InChIKey | OEERWEDKIZUZJF-NSHDSACASA-N |
| XLogP | 1.64 |
| TPSA | 87.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.39 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |