C25H19NO5 — CID 7786473
[2-(2,3-dihydro-1,4-benzodioxin-6-ylamino)-2-oxoethyl] anthracene-9-carboxylate (PubChem CID 7786473) has the molecular formula C25H19NO5 and a molecular weight of 413.43 g/mol. Its IUPAC name is [2-(2,3-dihydro-1,4-benzodioxin-6-ylamino)-2-oxoethyl] anthracene-9-carboxylate.
| Compound Name | [2-(2,3-dihydro-1,4-benzodioxin-6-ylamino)-2-oxoethyl] anthracene-9-carboxylate |
|---|---|
| PubChem CID | 7786473 |
| Molecular Formula | C25H19NO5 |
| Molecular Weight | 413.43 g/mol |
| Exact Mass | 413.13 |
| IUPAC Name | [2-(2,3-dihydro-1,4-benzodioxin-6-ylamino)-2-oxoethyl] anthracene-9-carboxylate |
| SMILES | O=C(COC(=O)c1c2ccccc2cc2ccccc12)Nc1ccc2c(c1)OCCO2 |
| InChI | InChI=1S/C25H19NO5/c27-23(26-18-9-10-21-22(14-18)30-12-11-29-21)15-31-25(28)24-19-7-3-1-5-16(19)13-17-6-2-4-8-20(17)24/h1-10,13-14H,11-12,15H2,(H,26,27) |
| InChIKey | JDVWKKBMJTUETN-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.43 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|