About trans-(1S,2S)-cyclopentane-1,2-dicarboxamide
trans-(1S,2S)-cyclopentane-1,2-dicarboxamide (PubChem CID 778723) has the molecular formula C7H12N2O2
and a molecular weight of 156.18 g/mol. Its IUPAC name is trans-(1S,2S)-cyclopentane-1,2-dicarboxamide.
Molecular Properties
| Compound Name | trans-(1S,2S)-cyclopentane-1,2-dicarboxamide |
| PubChem CID | 778723 |
| Molecular Formula | C7H12N2O2 |
| Molecular Weight | 156.18 g/mol |
| Exact Mass | 156.09 |
| IUPAC Name | trans-(1S,2S)-cyclopentane-1,2-dicarboxamide |
| SMILES | NC(=O)[C@H]1CCC[C@@H]1C(N)=O |
| InChI | InChI=1S/C7H12N2O2/c8-6(10)4-2-1-3-5(4)7(9)11/h4-5H,1-3H2,(H2,8,10)(H2,9,11)/t4-,5-/m0/s1 |
| InChIKey | MLNHEBAJXZVWER-WHFBIAKZSA-N |
| XLogP | -0.63 |
| TPSA | 86.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 156.18 |
| LogP ≤ 5 | -0.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze trans-(1S,2S)-cyclopentane-1,2-dicarboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of trans-(1S,2S)-cyclopentane-1,2-dicarboxamide?
The IUPAC name of trans-(1S,2S)-cyclopentane-1,2-dicarboxamide (CID 778723) is trans-(1S,2S)-cyclopentane-1,2-dicarboxamide.
What is the SMILES notation for trans-(1S,2S)-cyclopentane-1,2-dicarboxamide?
The canonical SMILES for trans-(1S,2S)-cyclopentane-1,2-dicarboxamide is NC(=O)[C@H]1CCC[C@@H]1C(N)=O.
What is the InChIKey of trans-(1S,2S)-cyclopentane-1,2-dicarboxamide?
The InChIKey is MLNHEBAJXZVWER-WHFBIAKZSA-N. The full InChI is InChI=1S/C7H12N2O2/c8-6(10)4-2-1-3-5(4)7(9)11/h4-5H,1-3H2,(H2,8,10)(H2,9,11)/t4-,5-/m0/s1.
What are the key properties of trans-(1S,2S)-cyclopentane-1,2-dicarboxamide?
trans-(1S,2S)-cyclopentane-1,2-dicarboxamide has a molecular weight of 156.18 g/mol, XLogP of -0.63, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for trans-(1S,2S)-cyclopentane-1,2-dicarboxamide is sourced from PubChem (CID 778723), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).