C16H14Cl3NO2 — CID 7787848
N-[(1S)-1-(3-chlorophenyl)ethyl]-2-(2,3-dichlorophenoxy)acetamide (PubChem CID 7787848) has the molecular formula C16H14Cl3NO2 and a molecular weight of 358.65 g/mol. Its IUPAC name is N-[(1S)-1-(3-chlorophenyl)ethyl]-2-(2,3-dichlorophenoxy)acetamide.
| Compound Name | N-[(1S)-1-(3-chlorophenyl)ethyl]-2-(2,3-dichlorophenoxy)acetamide |
|---|---|
| PubChem CID | 7787848 |
| Molecular Formula | C16H14Cl3NO2 |
| Molecular Weight | 358.65 g/mol |
| Exact Mass | 357.01 |
| IUPAC Name | N-[(1S)-1-(3-chlorophenyl)ethyl]-2-(2,3-dichlorophenoxy)acetamide |
| SMILES | C[C@H](NC(=O)COc1cccc(Cl)c1Cl)c1cccc(Cl)c1 |
| InChI | InChI=1S/C16H14Cl3NO2/c1-10(11-4-2-5-12(17)8-11)20-15(21)9-22-14-7-3-6-13(18)16(14)19/h2-8,10H,9H2,1H3,(H,20,21)/t10-/m0/s1 |
| InChIKey | AVHXUOQOYRGJGI-JTQLQIEISA-N |
| XLogP | 4.90 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.65 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |