C21H25NO3 — CID 7788075
N-[(1R)-1-(3,4-dimethylphenyl)ethyl]-2-(4-propanoylphenoxy)acetamide (PubChem CID 7788075) has the molecular formula C21H25NO3 and a molecular weight of 339.44 g/mol. Its IUPAC name is N-[(1R)-1-(3,4-dimethylphenyl)ethyl]-2-(4-propanoylphenoxy)acetamide.
| Compound Name | N-[(1R)-1-(3,4-dimethylphenyl)ethyl]-2-(4-propanoylphenoxy)acetamide |
|---|---|
| PubChem CID | 7788075 |
| Molecular Formula | C21H25NO3 |
| Molecular Weight | 339.44 g/mol |
| Exact Mass | 339.18 |
| IUPAC Name | N-[(1R)-1-(3,4-dimethylphenyl)ethyl]-2-(4-propanoylphenoxy)acetamide |
| SMILES | CCC(=O)c1ccc(OCC(=O)N[C@H](C)c2ccc(C)c(C)c2)cc1 |
| InChI | InChI=1S/C21H25NO3/c1-5-20(23)17-8-10-19(11-9-17)25-13-21(24)22-16(4)18-7-6-14(2)15(3)12-18/h6-12,16H,5,13H2,1-4H3,(H,22,24)/t16-/m1/s1 |
| InChIKey | WFFLQITXLKFNIK-MRXNPFEDSA-N |
| XLogP | 4.15 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.44 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |