About propylsulfinylbenzene
propylsulfinylbenzene (PubChem CID 778847) has the molecular formula C9H12OS
and a molecular weight of 168.26 g/mol. Its IUPAC name is propylsulfinylbenzene.
Molecular Properties
| Compound Name | propylsulfinylbenzene |
| PubChem CID | 778847 |
| Molecular Formula | C9H12OS |
| Molecular Weight | 168.26 g/mol |
| Exact Mass | 168.06 |
| IUPAC Name | propylsulfinylbenzene |
| SMILES | CCCS(=O)c1ccccc1 |
| InChI | InChI=1S/C9H12OS/c1-2-8-11(10)9-6-4-3-5-7-9/h3-7H,2,8H2,1H3 |
| InChIKey | QVRZWGALJMYTDQ-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 168.26 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze propylsulfinylbenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of propylsulfinylbenzene?
The IUPAC name of propylsulfinylbenzene (CID 778847) is propylsulfinylbenzene.
What is the SMILES notation for propylsulfinylbenzene?
The canonical SMILES for propylsulfinylbenzene is CCCS(=O)c1ccccc1.
What is the InChIKey of propylsulfinylbenzene?
The InChIKey is QVRZWGALJMYTDQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12OS/c1-2-8-11(10)9-6-4-3-5-7-9/h3-7H,2,8H2,1H3.
What are the key properties of propylsulfinylbenzene?
propylsulfinylbenzene has a molecular weight of 168.26 g/mol, XLogP of 2.20, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for propylsulfinylbenzene is sourced from PubChem (CID 778847), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).