About [2-[2-(4-fluorophenyl)ethylamino]-2-oxoethyl] 2-(2,5-dimethylphenyl)sulfanylacetate
[2-[2-(4-fluorophenyl)ethylamino]-2-oxoethyl] 2-(2,5-dimethylphenyl)sulfanylacetate (PubChem CID 7788492) has the molecular formula C20H22FNO3S
and a molecular weight of 375.47 g/mol. Its IUPAC name is [2-[2-(4-fluorophenyl)ethylamino]-2-oxoethyl] 2-(2,5-dimethylphenyl)sulfanylacetate.
Molecular Properties
| Compound Name | [2-[2-(4-fluorophenyl)ethylamino]-2-oxoethyl] 2-(2,5-dimethylphenyl)sulfanylacetate |
| PubChem CID | 7788492 |
| Molecular Formula | C20H22FNO3S |
| Molecular Weight | 375.47 g/mol |
| Exact Mass | 375.13 |
| IUPAC Name | [2-[2-(4-fluorophenyl)ethylamino]-2-oxoethyl] 2-(2,5-dimethylphenyl)sulfanylacetate |
| SMILES | Cc1ccc(C)c(SCC(=O)OCC(=O)NCCc2ccc(F)cc2)c1 |
| InChI | InChI=1S/C20H22FNO3S/c1-14-3-4-15(2)18(11-14)26-13-20(24)25-12-19(23)22-10-9-16-5-7-17(21)8-6-16/h3-8,11H,9-10,12-13H2,1-2H3,(H,22,23) |
| InChIKey | ZUGSALXCNORAFR-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 375.47 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze [2-[2-(4-fluorophenyl)ethylamino]-2-oxoethyl] 2-(2,5-dimethylphenyl)sulfanylacetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-[2-(4-fluorophenyl)ethylamino]-2-oxoethyl] 2-(2,5-dimethylphenyl)sulfanylacetate?
The IUPAC name of [2-[2-(4-fluorophenyl)ethylamino]-2-oxoethyl] 2-(2,5-dimethylphenyl)sulfanylacetate (CID 7788492) is [2-[2-(4-fluorophenyl)ethylamino]-2-oxoethyl] 2-(2,5-dimethylphenyl)sulfanylacetate.
What is the SMILES notation for [2-[2-(4-fluorophenyl)ethylamino]-2-oxoethyl] 2-(2,5-dimethylphenyl)sulfanylacetate?
The canonical SMILES for [2-[2-(4-fluorophenyl)ethylamino]-2-oxoethyl] 2-(2,5-dimethylphenyl)sulfanylacetate is Cc1ccc(C)c(SCC(=O)OCC(=O)NCCc2ccc(F)cc2)c1.
What is the InChIKey of [2-[2-(4-fluorophenyl)ethylamino]-2-oxoethyl] 2-(2,5-dimethylphenyl)sulfanylacetate?
The InChIKey is ZUGSALXCNORAFR-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H22FNO3S/c1-14-3-4-15(2)18(11-14)26-13-20(24)25-12-19(23)22-10-9-16-5-7-17(21)8-6-16/h3-8,11H,9-10,12-13H2,1-2H3,(H,22,23).
What are the key properties of [2-[2-(4-fluorophenyl)ethylamino]-2-oxoethyl] 2-(2,5-dimethylphenyl)sulfanylacetate?
[2-[2-(4-fluorophenyl)ethylamino]-2-oxoethyl] 2-(2,5-dimethylphenyl)sulfanylacetate has a molecular weight of 375.47 g/mol, XLogP of 3.44, 8 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [2-[2-(4-fluorophenyl)ethylamino]-2-oxoethyl] 2-(2,5-dimethylphenyl)sulfanylacetate is sourced from PubChem (CID 7788492), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).