C16H13Cl2NO6 — CID 7789050
2-(2,6-dichlorophenoxy)ethyl 2-(2-nitrophenoxy)acetate (PubChem CID 7789050) has the molecular formula C16H13Cl2NO6 and a molecular weight of 386.19 g/mol. Its IUPAC name is 2-(2,6-dichlorophenoxy)ethyl 2-(2-nitrophenoxy)acetate.
| Compound Name | 2-(2,6-dichlorophenoxy)ethyl 2-(2-nitrophenoxy)acetate |
|---|---|
| PubChem CID | 7789050 |
| Molecular Formula | C16H13Cl2NO6 |
| Molecular Weight | 386.19 g/mol |
| Exact Mass | 385.01 |
| IUPAC Name | 2-(2,6-dichlorophenoxy)ethyl 2-(2-nitrophenoxy)acetate |
| SMILES | O=C(COc1ccccc1[N+](=O)[O-])OCCOc1c(Cl)cccc1Cl |
| InChI | InChI=1S/C16H13Cl2NO6/c17-11-4-3-5-12(18)16(11)24-9-8-23-15(20)10-25-14-7-2-1-6-13(14)19(21)22/h1-7H,8-10H2 |
| InChIKey | NKYHGTTYNQCDTQ-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 87.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.19 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|