C13H17N3O3S2 — CID 778910
ethyl 4-(thiophene-2-carbonylcarbamothioyl)piperazine-1-carboxylate (PubChem CID 778910) has the molecular formula C13H17N3O3S2 and a molecular weight of 327.43 g/mol. Its IUPAC name is ethyl 4-(thiophene-2-carbonylcarbamothioyl)piperazine-1-carboxylate.
| Compound Name | ethyl 4-(thiophene-2-carbonylcarbamothioyl)piperazine-1-carboxylate |
|---|---|
| PubChem CID | 778910 |
| Molecular Formula | C13H17N3O3S2 |
| Molecular Weight | 327.43 g/mol |
| Exact Mass | 327.07 |
| IUPAC Name | ethyl 4-(thiophene-2-carbonylcarbamothioyl)piperazine-1-carboxylate |
| SMILES | CCOC(=O)N1CCN(C(=S)NC(=O)c2cccs2)CC1 |
| InChI | InChI=1S/C13H17N3O3S2/c1-2-19-13(18)16-7-5-15(6-8-16)12(20)14-11(17)10-4-3-9-21-10/h3-4,9H,2,5-8H2,1H3,(H,14,17,20) |
| InChIKey | PVTZZDSRAFGBHD-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.43 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|