About [2-(N-acetyl-2-fluoroanilino)-1,3-thiazol-4-yl]methyl 4-fluorobenzoate
[2-(N-acetyl-2-fluoroanilino)-1,3-thiazol-4-yl]methyl 4-fluorobenzoate (PubChem CID 7789280) has the molecular formula C19H14F2N2O3S
and a molecular weight of 388.40 g/mol. Its IUPAC name is [2-(N-acetyl-2-fluoroanilino)-1,3-thiazol-4-yl]methyl 4-fluorobenzoate.
Molecular Properties
| Compound Name | [2-(N-acetyl-2-fluoroanilino)-1,3-thiazol-4-yl]methyl 4-fluorobenzoate |
| PubChem CID | 7789280 |
| Molecular Formula | C19H14F2N2O3S |
| Molecular Weight | 388.40 g/mol |
| Exact Mass | 388.07 |
| IUPAC Name | [2-(N-acetyl-2-fluoroanilino)-1,3-thiazol-4-yl]methyl 4-fluorobenzoate |
| SMILES | CC(=O)N(c1nc(COC(=O)c2ccc(F)cc2)cs1)c1ccccc1F |
| InChI | InChI=1S/C19H14F2N2O3S/c1-12(24)23(17-5-3-2-4-16(17)21)19-22-15(11-27-19)10-26-18(25)13-6-8-14(20)9-7-13/h2-9,11H,10H2,1H3 |
| InChIKey | XBZJVUVROGTXJS-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 59.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 388.40 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze [2-(N-acetyl-2-fluoroanilino)-1,3-thiazol-4-yl]methyl 4-fluorobenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-(N-acetyl-2-fluoroanilino)-1,3-thiazol-4-yl]methyl 4-fluorobenzoate?
The IUPAC name of [2-(N-acetyl-2-fluoroanilino)-1,3-thiazol-4-yl]methyl 4-fluorobenzoate (CID 7789280) is [2-(N-acetyl-2-fluoroanilino)-1,3-thiazol-4-yl]methyl 4-fluorobenzoate.
What is the SMILES notation for [2-(N-acetyl-2-fluoroanilino)-1,3-thiazol-4-yl]methyl 4-fluorobenzoate?
The canonical SMILES for [2-(N-acetyl-2-fluoroanilino)-1,3-thiazol-4-yl]methyl 4-fluorobenzoate is CC(=O)N(c1nc(COC(=O)c2ccc(F)cc2)cs1)c1ccccc1F.
What is the InChIKey of [2-(N-acetyl-2-fluoroanilino)-1,3-thiazol-4-yl]methyl 4-fluorobenzoate?
The InChIKey is XBZJVUVROGTXJS-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H14F2N2O3S/c1-12(24)23(17-5-3-2-4-16(17)21)19-22-15(11-27-19)10-26-18(25)13-6-8-14(20)9-7-13/h2-9,11H,10H2,1H3.
What are the key properties of [2-(N-acetyl-2-fluoroanilino)-1,3-thiazol-4-yl]methyl 4-fluorobenzoate?
[2-(N-acetyl-2-fluoroanilino)-1,3-thiazol-4-yl]methyl 4-fluorobenzoate has a molecular weight of 388.40 g/mol, XLogP of 4.46, 5 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [2-(N-acetyl-2-fluoroanilino)-1,3-thiazol-4-yl]methyl 4-fluorobenzoate is sourced from PubChem (CID 7789280), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).