About 2-(4-bromophenyl)-5,6-dihydropyrrolo[2,1-a]isoquinoline
2-(4-bromophenyl)-5,6-dihydropyrrolo[2,1-a]isoquinoline (PubChem CID 778929) has the molecular formula C18H14BrN
and a molecular weight of 324.22 g/mol. Its IUPAC name is 2-(4-bromophenyl)-5,6-dihydropyrrolo[2,1-a]isoquinoline.
Molecular Properties
| Compound Name | 2-(4-bromophenyl)-5,6-dihydropyrrolo[2,1-a]isoquinoline |
| PubChem CID | 778929 |
| Molecular Formula | C18H14BrN |
| Molecular Weight | 324.22 g/mol |
| Exact Mass | 323.03 |
| IUPAC Name | 2-(4-bromophenyl)-5,6-dihydropyrrolo[2,1-a]isoquinoline |
| SMILES | Brc1ccc(-c2cc3n(c2)CCc2ccccc2-3)cc1 |
| InChI | InChI=1S/C18H14BrN/c19-16-7-5-13(6-8-16)15-11-18-17-4-2-1-3-14(17)9-10-20(18)12-15/h1-8,11-12H,9-10H2 |
| InChIKey | JPYRDHCTVORWRW-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 4.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 324.22 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2-(4-bromophenyl)-5,6-dihydropyrrolo[2,1-a]isoquinoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4-bromophenyl)-5,6-dihydropyrrolo[2,1-a]isoquinoline?
The IUPAC name of 2-(4-bromophenyl)-5,6-dihydropyrrolo[2,1-a]isoquinoline (CID 778929) is 2-(4-bromophenyl)-5,6-dihydropyrrolo[2,1-a]isoquinoline.
What is the SMILES notation for 2-(4-bromophenyl)-5,6-dihydropyrrolo[2,1-a]isoquinoline?
The canonical SMILES for 2-(4-bromophenyl)-5,6-dihydropyrrolo[2,1-a]isoquinoline is Brc1ccc(-c2cc3n(c2)CCc2ccccc2-3)cc1.
What is the InChIKey of 2-(4-bromophenyl)-5,6-dihydropyrrolo[2,1-a]isoquinoline?
The InChIKey is JPYRDHCTVORWRW-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H14BrN/c19-16-7-5-13(6-8-16)15-11-18-17-4-2-1-3-14(17)9-10-20(18)12-15/h1-8,11-12H,9-10H2.
What are the key properties of 2-(4-bromophenyl)-5,6-dihydropyrrolo[2,1-a]isoquinoline?
2-(4-bromophenyl)-5,6-dihydropyrrolo[2,1-a]isoquinoline has a molecular weight of 324.22 g/mol, XLogP of 5.14, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4-bromophenyl)-5,6-dihydropyrrolo[2,1-a]isoquinoline is sourced from PubChem (CID 778929), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).