About N-[(E)-2,3-dihydroinden-1-ylideneamino]-2-[3-(trifluoromethyl)pyrazol-1-yl]acetamide
N-[(E)-2,3-dihydroinden-1-ylideneamino]-2-[3-(trifluoromethyl)pyrazol-1-yl]acetamide (PubChem CID 7789881) has the molecular formula C15H13F3N4O
and a molecular weight of 322.29 g/mol. Its IUPAC name is N-[(E)-2,3-dihydroinden-1-ylideneamino]-2-[3-(trifluoromethyl)pyrazol-1-yl]acetamide.
Molecular Properties
| Compound Name | N-[(E)-2,3-dihydroinden-1-ylideneamino]-2-[3-(trifluoromethyl)pyrazol-1-yl]acetamide |
| PubChem CID | 7789881 |
| Molecular Formula | C15H13F3N4O |
| Molecular Weight | 322.29 g/mol |
| Exact Mass | 322.10 |
| IUPAC Name | N-[(E)-2,3-dihydroinden-1-ylideneamino]-2-[3-(trifluoromethyl)pyrazol-1-yl]acetamide |
| SMILES | O=C(Cn1ccc(C(F)(F)F)n1)N/N=C1\CCc2ccccc21 |
| InChI | InChI=1S/C15H13F3N4O/c16-15(17,18)13-7-8-22(21-13)9-14(23)20-19-12-6-5-10-3-1-2-4-11(10)12/h1-4,7-8H,5-6,9H2,(H,20,23)/b19-12+ |
| InChIKey | AIXDPIKUWVQLLC-XDHOZWIPSA-N |
| XLogP | 2.37 |
| TPSA | 59.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 322.29 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N-[(E)-2,3-dihydroinden-1-ylideneamino]-2-[3-(trifluoromethyl)pyrazol-1-yl]acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(E)-2,3-dihydroinden-1-ylideneamino]-2-[3-(trifluoromethyl)pyrazol-1-yl]acetamide?
The IUPAC name of N-[(E)-2,3-dihydroinden-1-ylideneamino]-2-[3-(trifluoromethyl)pyrazol-1-yl]acetamide (CID 7789881) is N-[(E)-2,3-dihydroinden-1-ylideneamino]-2-[3-(trifluoromethyl)pyrazol-1-yl]acetamide.
What is the SMILES notation for N-[(E)-2,3-dihydroinden-1-ylideneamino]-2-[3-(trifluoromethyl)pyrazol-1-yl]acetamide?
The canonical SMILES for N-[(E)-2,3-dihydroinden-1-ylideneamino]-2-[3-(trifluoromethyl)pyrazol-1-yl]acetamide is O=C(Cn1ccc(C(F)(F)F)n1)N/N=C1\CCc2ccccc21.
What is the InChIKey of N-[(E)-2,3-dihydroinden-1-ylideneamino]-2-[3-(trifluoromethyl)pyrazol-1-yl]acetamide?
The InChIKey is AIXDPIKUWVQLLC-XDHOZWIPSA-N. The full InChI is InChI=1S/C15H13F3N4O/c16-15(17,18)13-7-8-22(21-13)9-14(23)20-19-12-6-5-10-3-1-2-4-11(10)12/h1-4,7-8H,5-6,9H2,(H,20,23)/b19-12+.
What are the key properties of N-[(E)-2,3-dihydroinden-1-ylideneamino]-2-[3-(trifluoromethyl)pyrazol-1-yl]acetamide?
N-[(E)-2,3-dihydroinden-1-ylideneamino]-2-[3-(trifluoromethyl)pyrazol-1-yl]acetamide has a molecular weight of 322.29 g/mol, XLogP of 2.37, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(E)-2,3-dihydroinden-1-ylideneamino]-2-[3-(trifluoromethyl)pyrazol-1-yl]acetamide is sourced from PubChem (CID 7789881), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).