C17H16ClNO3S — CID 7790658
[(2R)-1-amino-1-oxopropan-2-yl] 3-[(4-chlorophenyl)sulfanylmethyl]benzoate (PubChem CID 7790658) has the molecular formula C17H16ClNO3S and a molecular weight of 349.84 g/mol. Its IUPAC name is [(2R)-1-amino-1-oxopropan-2-yl] 3-[(4-chlorophenyl)sulfanylmethyl]benzoate.
| Compound Name | [(2R)-1-amino-1-oxopropan-2-yl] 3-[(4-chlorophenyl)sulfanylmethyl]benzoate |
|---|---|
| PubChem CID | 7790658 |
| Molecular Formula | C17H16ClNO3S |
| Molecular Weight | 349.84 g/mol |
| Exact Mass | 349.05 |
| IUPAC Name | [(2R)-1-amino-1-oxopropan-2-yl] 3-[(4-chlorophenyl)sulfanylmethyl]benzoate |
| SMILES | C[C@@H](OC(=O)c1cccc(CSc2ccc(Cl)cc2)c1)C(N)=O |
| InChI | InChI=1S/C17H16ClNO3S/c1-11(16(19)20)22-17(21)13-4-2-3-12(9-13)10-23-15-7-5-14(18)6-8-15/h2-9,11H,10H2,1H3,(H2,19,20)/t11-/m1/s1 |
| InChIKey | XGRSBMZUOSKKAE-LLVKDONJSA-N |
| XLogP | 3.66 |
| TPSA | 69.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.84 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |