C18H25NO5 — CID 7790922
[2-(tert-butylamino)-2-oxoethyl] (E)-3-(3-ethoxy-4-methoxyphenyl)prop-2-enoate (PubChem CID 7790922) has the molecular formula C18H25NO5 and a molecular weight of 335.40 g/mol. Its IUPAC name is [2-(tert-butylamino)-2-oxoethyl] (E)-3-(3-ethoxy-4-methoxyphenyl)prop-2-enoate.
| Compound Name | [2-(tert-butylamino)-2-oxoethyl] (E)-3-(3-ethoxy-4-methoxyphenyl)prop-2-enoate |
|---|---|
| PubChem CID | 7790922 |
| Molecular Formula | C18H25NO5 |
| Molecular Weight | 335.40 g/mol |
| Exact Mass | 335.17 |
| IUPAC Name | [2-(tert-butylamino)-2-oxoethyl] (E)-3-(3-ethoxy-4-methoxyphenyl)prop-2-enoate |
| SMILES | CCOc1cc(/C=C/C(=O)OCC(=O)NC(C)(C)C)ccc1OC |
| InChI | InChI=1S/C18H25NO5/c1-6-23-15-11-13(7-9-14(15)22-5)8-10-17(21)24-12-16(20)19-18(2,3)4/h7-11H,6,12H2,1-5H3,(H,19,20)/b10-8+ |
| InChIKey | BEQOKHZAJBWIQN-CSKARUKUSA-N |
| XLogP | 2.57 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.40 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|