About [2-(N-acetylanilino)-1,3-thiazol-4-yl]methyl 2-(4-fluorophenoxy)acetate
[2-(N-acetylanilino)-1,3-thiazol-4-yl]methyl 2-(4-fluorophenoxy)acetate (PubChem CID 7791256) has the molecular formula C20H17FN2O4S
and a molecular weight of 400.43 g/mol. Its IUPAC name is [2-(N-acetylanilino)-1,3-thiazol-4-yl]methyl 2-(4-fluorophenoxy)acetate.
Molecular Properties
| Compound Name | [2-(N-acetylanilino)-1,3-thiazol-4-yl]methyl 2-(4-fluorophenoxy)acetate |
| PubChem CID | 7791256 |
| Molecular Formula | C20H17FN2O4S |
| Molecular Weight | 400.43 g/mol |
| Exact Mass | 400.09 |
| IUPAC Name | [2-(N-acetylanilino)-1,3-thiazol-4-yl]methyl 2-(4-fluorophenoxy)acetate |
| SMILES | CC(=O)N(c1ccccc1)c1nc(COC(=O)COc2ccc(F)cc2)cs1 |
| InChI | InChI=1S/C20H17FN2O4S/c1-14(24)23(17-5-3-2-4-6-17)20-22-16(13-28-20)11-27-19(25)12-26-18-9-7-15(21)8-10-18/h2-10,13H,11-12H2,1H3 |
| InChIKey | NAKXJDQTKSPEGH-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 68.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 400.43 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze [2-(N-acetylanilino)-1,3-thiazol-4-yl]methyl 2-(4-fluorophenoxy)acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-(N-acetylanilino)-1,3-thiazol-4-yl]methyl 2-(4-fluorophenoxy)acetate?
The IUPAC name of [2-(N-acetylanilino)-1,3-thiazol-4-yl]methyl 2-(4-fluorophenoxy)acetate (CID 7791256) is [2-(N-acetylanilino)-1,3-thiazol-4-yl]methyl 2-(4-fluorophenoxy)acetate.
What is the SMILES notation for [2-(N-acetylanilino)-1,3-thiazol-4-yl]methyl 2-(4-fluorophenoxy)acetate?
The canonical SMILES for [2-(N-acetylanilino)-1,3-thiazol-4-yl]methyl 2-(4-fluorophenoxy)acetate is CC(=O)N(c1ccccc1)c1nc(COC(=O)COc2ccc(F)cc2)cs1.
What is the InChIKey of [2-(N-acetylanilino)-1,3-thiazol-4-yl]methyl 2-(4-fluorophenoxy)acetate?
The InChIKey is NAKXJDQTKSPEGH-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H17FN2O4S/c1-14(24)23(17-5-3-2-4-6-17)20-22-16(13-28-20)11-27-19(25)12-26-18-9-7-15(21)8-10-18/h2-10,13H,11-12H2,1H3.
What are the key properties of [2-(N-acetylanilino)-1,3-thiazol-4-yl]methyl 2-(4-fluorophenoxy)acetate?
[2-(N-acetylanilino)-1,3-thiazol-4-yl]methyl 2-(4-fluorophenoxy)acetate has a molecular weight of 400.43 g/mol, XLogP of 4.09, 7 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [2-(N-acetylanilino)-1,3-thiazol-4-yl]methyl 2-(4-fluorophenoxy)acetate is sourced from PubChem (CID 7791256), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).