C17H15FN2O5 — CID 7791695
[2-(4-carbamoylanilino)-2-oxoethyl] 2-(4-fluorophenoxy)acetate (PubChem CID 7791695) has the molecular formula C17H15FN2O5 and a molecular weight of 346.31 g/mol. Its IUPAC name is [2-(4-carbamoylanilino)-2-oxoethyl] 2-(4-fluorophenoxy)acetate.
| Compound Name | [2-(4-carbamoylanilino)-2-oxoethyl] 2-(4-fluorophenoxy)acetate |
|---|---|
| PubChem CID | 7791695 |
| Molecular Formula | C17H15FN2O5 |
| Molecular Weight | 346.31 g/mol |
| Exact Mass | 346.10 |
| IUPAC Name | [2-(4-carbamoylanilino)-2-oxoethyl] 2-(4-fluorophenoxy)acetate |
| SMILES | NC(=O)c1ccc(NC(=O)COC(=O)COc2ccc(F)cc2)cc1 |
| InChI | InChI=1S/C17H15FN2O5/c18-12-3-7-14(8-4-12)24-10-16(22)25-9-15(21)20-13-5-1-11(2-6-13)17(19)23/h1-8H,9-10H2,(H2,19,23)(H,20,21) |
| InChIKey | QISAEQOAQSQPKF-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 107.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.31 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |