About N-benzyl-N,2-dimethylbenzamide
N-benzyl-N,2-dimethylbenzamide (PubChem CID 779170) has the molecular formula C16H17NO
and a molecular weight of 239.32 g/mol. Its IUPAC name is N-benzyl-N,2-dimethylbenzamide.
Molecular Properties
| Compound Name | N-benzyl-N,2-dimethylbenzamide |
| PubChem CID | 779170 |
| Molecular Formula | C16H17NO |
| Molecular Weight | 239.32 g/mol |
| Exact Mass | 239.13 |
| IUPAC Name | N-benzyl-N,2-dimethylbenzamide |
| SMILES | Cc1ccccc1C(=O)N(C)Cc1ccccc1 |
| InChI | InChI=1S/C16H17NO/c1-13-8-6-7-11-15(13)16(18)17(2)12-14-9-4-3-5-10-14/h3-11H,12H2,1-2H3 |
| InChIKey | WWGMRQYIAABIDX-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 239.32 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze N-benzyl-N,2-dimethylbenzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-benzyl-N,2-dimethylbenzamide?
The IUPAC name of N-benzyl-N,2-dimethylbenzamide (CID 779170) is N-benzyl-N,2-dimethylbenzamide.
What is the SMILES notation for N-benzyl-N,2-dimethylbenzamide?
The canonical SMILES for N-benzyl-N,2-dimethylbenzamide is Cc1ccccc1C(=O)N(C)Cc1ccccc1.
What is the InChIKey of N-benzyl-N,2-dimethylbenzamide?
The InChIKey is WWGMRQYIAABIDX-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H17NO/c1-13-8-6-7-11-15(13)16(18)17(2)12-14-9-4-3-5-10-14/h3-11H,12H2,1-2H3.
What are the key properties of N-benzyl-N,2-dimethylbenzamide?
N-benzyl-N,2-dimethylbenzamide has a molecular weight of 239.32 g/mol, XLogP of 3.27, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-benzyl-N,2-dimethylbenzamide is sourced from PubChem (CID 779170), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).