C20H30N5O2S+ — CID 7791996
2-[[4-benzyl-5-(piperidin-1-ium-1-ylmethyl)-1,2,4-triazol-3-yl]sulfanyl]-N-(2-methoxyethyl)acetamide (PubChem CID 7791996) has the molecular formula C20H30N5O2S+ and a molecular weight of 404.56 g/mol. Its IUPAC name is 2-[[4-benzyl-5-(piperidin-1-ium-1-ylmethyl)-1,2,4-triazol-3-yl]sulfanyl]-N-(2-methoxyethyl)acetamide.
| Compound Name | 2-[[4-benzyl-5-(piperidin-1-ium-1-ylmethyl)-1,2,4-triazol-3-yl]sulfanyl]-N-(2-methoxyethyl)acetamide |
|---|---|
| PubChem CID | 7791996 |
| Molecular Formula | C20H30N5O2S+ |
| Molecular Weight | 404.56 g/mol |
| Exact Mass | 404.21 |
| IUPAC Name | 2-[[4-benzyl-5-(piperidin-1-ium-1-ylmethyl)-1,2,4-triazol-3-yl]sulfanyl]-N-(2-methoxyethyl)acetamide |
| SMILES | COCCNC(=O)CSc1nnc(C[NH+]2CCCCC2)n1Cc1ccccc1 |
| InChI | InChI=1S/C20H29N5O2S/c1-27-13-10-21-19(26)16-28-20-23-22-18(15-24-11-6-3-7-12-24)25(20)14-17-8-4-2-5-9-17/h2,4-5,8-9H,3,6-7,10-16H2,1H3,(H,21,26)/p+1 |
| InChIKey | RJRYBVWOBOPNGG-UHFFFAOYSA-O |
| XLogP | 0.75 |
| TPSA | 73.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.56 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|