C23H23N3O3S — CID 7792983
[2-oxo-2-(2-phenylsulfanylanilino)ethyl] (E)-3-(1,3,5-trimethylpyrazol-4-yl)prop-2-enoate (PubChem CID 7792983) has the molecular formula C23H23N3O3S and a molecular weight of 421.52 g/mol. Its IUPAC name is [2-oxo-2-(2-phenylsulfanylanilino)ethyl] (E)-3-(1,3,5-trimethylpyrazol-4-yl)prop-2-enoate.
| Compound Name | [2-oxo-2-(2-phenylsulfanylanilino)ethyl] (E)-3-(1,3,5-trimethylpyrazol-4-yl)prop-2-enoate |
|---|---|
| PubChem CID | 7792983 |
| Molecular Formula | C23H23N3O3S |
| Molecular Weight | 421.52 g/mol |
| Exact Mass | 421.15 |
| IUPAC Name | [2-oxo-2-(2-phenylsulfanylanilino)ethyl] (E)-3-(1,3,5-trimethylpyrazol-4-yl)prop-2-enoate |
| SMILES | Cc1nn(C)c(C)c1/C=C/C(=O)OCC(=O)Nc1ccccc1Sc1ccccc1 |
| InChI | InChI=1S/C23H23N3O3S/c1-16-19(17(2)26(3)25-16)13-14-23(28)29-15-22(27)24-20-11-7-8-12-21(20)30-18-9-5-4-6-10-18/h4-14H,15H2,1-3H3,(H,24,27)/b14-13+ |
| InChIKey | MJPZXEMKQJMVDT-BUHFOSPRSA-N |
| XLogP | 4.38 |
| TPSA | 73.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.52 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|