C20H19NOS — CID 7793117
(2R)-N-benzyl-2-naphthalen-2-ylsulfanylpropanamide (PubChem CID 7793117) has the molecular formula C20H19NOS and a molecular weight of 321.44 g/mol. Its IUPAC name is (2R)-N-benzyl-2-naphthalen-2-ylsulfanylpropanamide.
| Compound Name | (2R)-N-benzyl-2-naphthalen-2-ylsulfanylpropanamide |
|---|---|
| PubChem CID | 7793117 |
| Molecular Formula | C20H19NOS |
| Molecular Weight | 321.44 g/mol |
| Exact Mass | 321.12 |
| IUPAC Name | (2R)-N-benzyl-2-naphthalen-2-ylsulfanylpropanamide |
| SMILES | C[C@@H](Sc1ccc2ccccc2c1)C(=O)NCc1ccccc1 |
| InChI | InChI=1S/C20H19NOS/c1-15(20(22)21-14-16-7-3-2-4-8-16)23-19-12-11-17-9-5-6-10-18(17)13-19/h2-13,15H,14H2,1H3,(H,21,22)/t15-/m1/s1 |
| InChIKey | VCPNAKNSHXQFLW-OAHLLOKOSA-N |
| XLogP | 4.64 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.44 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |