About 2-phenoxy-1,3-benzothiazole
2-phenoxy-1,3-benzothiazole (PubChem CID 779423) has the molecular formula C13H9NOS
and a molecular weight of 227.29 g/mol. Its IUPAC name is 2-phenoxy-1,3-benzothiazole.
Molecular Properties
| Compound Name | 2-phenoxy-1,3-benzothiazole |
| PubChem CID | 779423 |
| Molecular Formula | C13H9NOS |
| Molecular Weight | 227.29 g/mol |
| Exact Mass | 227.04 |
| IUPAC Name | 2-phenoxy-1,3-benzothiazole |
| SMILES | c1ccc(Oc2nc3ccccc3s2)cc1 |
| InChI | InChI=1S/C13H9NOS/c1-2-6-10(7-3-1)15-13-14-11-8-4-5-9-12(11)16-13/h1-9H |
| InChIKey | MWTPXLULLUBAOP-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 227.29 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-phenoxy-1,3-benzothiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-phenoxy-1,3-benzothiazole?
The IUPAC name of 2-phenoxy-1,3-benzothiazole (CID 779423) is 2-phenoxy-1,3-benzothiazole.
What is the SMILES notation for 2-phenoxy-1,3-benzothiazole?
The canonical SMILES for 2-phenoxy-1,3-benzothiazole is c1ccc(Oc2nc3ccccc3s2)cc1.
What is the InChIKey of 2-phenoxy-1,3-benzothiazole?
The InChIKey is MWTPXLULLUBAOP-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H9NOS/c1-2-6-10(7-3-1)15-13-14-11-8-4-5-9-12(11)16-13/h1-9H.
What are the key properties of 2-phenoxy-1,3-benzothiazole?
2-phenoxy-1,3-benzothiazole has a molecular weight of 227.29 g/mol, XLogP of 4.09, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-phenoxy-1,3-benzothiazole is sourced from PubChem (CID 779423), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).