C11H10Cl2N4O — CID 779509
4,6-dichloro-N-(4-ethoxyphenyl)-1,3,5-triazin-2-amine (PubChem CID 779509) has the molecular formula C11H10Cl2N4O and a molecular weight of 285.13 g/mol. Its IUPAC name is 4,6-dichloro-N-(4-ethoxyphenyl)-1,3,5-triazin-2-amine.
| Compound Name | 4,6-dichloro-N-(4-ethoxyphenyl)-1,3,5-triazin-2-amine |
|---|---|
| PubChem CID | 779509 |
| Molecular Formula | C11H10Cl2N4O |
| Molecular Weight | 285.13 g/mol |
| Exact Mass | 284.02 |
| IUPAC Name | 4,6-dichloro-N-(4-ethoxyphenyl)-1,3,5-triazin-2-amine |
| SMILES | CCOc1ccc(Nc2nc(Cl)nc(Cl)n2)cc1 |
| InChI | InChI=1S/C11H10Cl2N4O/c1-2-18-8-5-3-7(4-6-8)14-11-16-9(12)15-10(13)17-11/h3-6H,2H2,1H3,(H,14,15,16,17) |
| InChIKey | BUCOSULJIXFZHS-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 59.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.13 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |