C19H21NO3 — CID 7796082
[(2S)-1-(3-methylanilino)-1-oxopropan-2-yl] 2,4-dimethylbenzoate (PubChem CID 7796082) has the molecular formula C19H21NO3 and a molecular weight of 311.38 g/mol. Its IUPAC name is [(2S)-1-(3-methylanilino)-1-oxopropan-2-yl] 2,4-dimethylbenzoate.
| Compound Name | [(2S)-1-(3-methylanilino)-1-oxopropan-2-yl] 2,4-dimethylbenzoate |
|---|---|
| PubChem CID | 7796082 |
| Molecular Formula | C19H21NO3 |
| Molecular Weight | 311.38 g/mol |
| Exact Mass | 311.15 |
| IUPAC Name | [(2S)-1-(3-methylanilino)-1-oxopropan-2-yl] 2,4-dimethylbenzoate |
| SMILES | Cc1cccc(NC(=O)[C@H](C)OC(=O)c2ccc(C)cc2C)c1 |
| InChI | InChI=1S/C19H21NO3/c1-12-6-5-7-16(11-12)20-18(21)15(4)23-19(22)17-9-8-13(2)10-14(17)3/h5-11,15H,1-4H3,(H,20,21)/t15-/m0/s1 |
| InChIKey | DJEJUCQISKCGOT-HNNXBMFYSA-N |
| XLogP | 3.80 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.38 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |