C19H14N2O6 — CID 7796956
[(E)-3-phenylprop-2-enyl] 2-(5-nitro-1,3-dioxoisoindol-2-yl)acetate (PubChem CID 7796956) has the molecular formula C19H14N2O6 and a molecular weight of 366.33 g/mol. Its IUPAC name is [(E)-3-phenylprop-2-enyl] 2-(5-nitro-1,3-dioxoisoindol-2-yl)acetate.
| Compound Name | [(E)-3-phenylprop-2-enyl] 2-(5-nitro-1,3-dioxoisoindol-2-yl)acetate |
|---|---|
| PubChem CID | 7796956 |
| Molecular Formula | C19H14N2O6 |
| Molecular Weight | 366.33 g/mol |
| Exact Mass | 366.09 |
| IUPAC Name | [(E)-3-phenylprop-2-enyl] 2-(5-nitro-1,3-dioxoisoindol-2-yl)acetate |
| SMILES | O=C(CN1C(=O)c2ccc([N+](=O)[O-])cc2C1=O)OC/C=C/c1ccccc1 |
| InChI | InChI=1S/C19H14N2O6/c22-17(27-10-4-7-13-5-2-1-3-6-13)12-20-18(23)15-9-8-14(21(25)26)11-16(15)19(20)24/h1-9,11H,10,12H2/b7-4+ |
| InChIKey | NNSGSNCLDBTOTI-QPJJXVBHSA-N |
| XLogP | 2.45 |
| TPSA | 106.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.33 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|