C9H11F3N4OS2 — CID 7797343
2-[[5-(prop-2-enylamino)-1,3,4-thiadiazol-2-yl]sulfanyl]-N-(2,2,2-trifluoroethyl)acetamide (PubChem CID 7797343) has the molecular formula C9H11F3N4OS2 and a molecular weight of 312.34 g/mol. Its IUPAC name is 2-[[5-(prop-2-enylamino)-1,3,4-thiadiazol-2-yl]sulfanyl]-N-(2,2,2-trifluoroethyl)acetamide.
| Compound Name | 2-[[5-(prop-2-enylamino)-1,3,4-thiadiazol-2-yl]sulfanyl]-N-(2,2,2-trifluoroethyl)acetamide |
|---|---|
| PubChem CID | 7797343 |
| Molecular Formula | C9H11F3N4OS2 |
| Molecular Weight | 312.34 g/mol |
| Exact Mass | 312.03 |
| IUPAC Name | 2-[[5-(prop-2-enylamino)-1,3,4-thiadiazol-2-yl]sulfanyl]-N-(2,2,2-trifluoroethyl)acetamide |
| SMILES | C=CCNc1nnc(SCC(=O)NCC(F)(F)F)s1 |
| InChI | InChI=1S/C9H11F3N4OS2/c1-2-3-13-7-15-16-8(19-7)18-4-6(17)14-5-9(10,11)12/h2H,1,3-5H2,(H,13,15)(H,14,17) |
| InChIKey | JKOMSCUCCMNBQE-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 66.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.34 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|