C9H11Cl2N3OS2 — CID 7797433
(1R)-2,2-dichloro-N-(4,5-dihydro-1,3-thiazol-2-ylcarbamothioyl)-1-methylcyclopropane-1-carboxamide (PubChem CID 7797433) has the molecular formula C9H11Cl2N3OS2 and a molecular weight of 312.25 g/mol. Its IUPAC name is (1R)-2,2-dichloro-N-(4,5-dihydro-1,3-thiazol-2-ylcarbamothioyl)-1-methylcyclopropane-1-carboxamide.
| Compound Name | (1R)-2,2-dichloro-N-(4,5-dihydro-1,3-thiazol-2-ylcarbamothioyl)-1-methylcyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 7797433 |
| Molecular Formula | C9H11Cl2N3OS2 |
| Molecular Weight | 312.25 g/mol |
| Exact Mass | 310.97 |
| IUPAC Name | (1R)-2,2-dichloro-N-(4,5-dihydro-1,3-thiazol-2-ylcarbamothioyl)-1-methylcyclopropane-1-carboxamide |
| SMILES | C[C@]1(C(=O)NC(=S)NC2=NCCS2)CC1(Cl)Cl |
| InChI | InChI=1S/C9H11Cl2N3OS2/c1-8(4-9(8,10)11)5(15)13-6(16)14-7-12-2-3-17-7/h2-4H2,1H3,(H2,12,13,14,15,16)/t8-/m1/s1 |
| InChIKey | KUVZJCAWDNYXBZ-MRVPVSSYSA-N |
| XLogP | 1.66 |
| TPSA | 53.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.25 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|