C12H11N5OS3 — CID 7797441
N-(3-cyanothiophen-2-yl)-2-[[5-(prop-2-enylamino)-1,3,4-thiadiazol-2-yl]sulfanyl]acetamide (PubChem CID 7797441) has the molecular formula C12H11N5OS3 and a molecular weight of 337.46 g/mol. Its IUPAC name is N-(3-cyanothiophen-2-yl)-2-[[5-(prop-2-enylamino)-1,3,4-thiadiazol-2-yl]sulfanyl]acetamide.
| Compound Name | N-(3-cyanothiophen-2-yl)-2-[[5-(prop-2-enylamino)-1,3,4-thiadiazol-2-yl]sulfanyl]acetamide |
|---|---|
| PubChem CID | 7797441 |
| Molecular Formula | C12H11N5OS3 |
| Molecular Weight | 337.46 g/mol |
| Exact Mass | 337.01 |
| IUPAC Name | N-(3-cyanothiophen-2-yl)-2-[[5-(prop-2-enylamino)-1,3,4-thiadiazol-2-yl]sulfanyl]acetamide |
| SMILES | C=CCNc1nnc(SCC(=O)Nc2sccc2C#N)s1 |
| InChI | InChI=1S/C12H11N5OS3/c1-2-4-14-11-16-17-12(21-11)20-7-9(18)15-10-8(6-13)3-5-19-10/h2-3,5H,1,4,7H2,(H,14,16)(H,15,18) |
| InChIKey | MWQOQYLBVSMEIU-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 90.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.46 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|