About (E)-1-(2,3-dihydroindol-1-yl)-3-(furan-2-yl)prop-2-en-1-one
(E)-1-(2,3-dihydroindol-1-yl)-3-(furan-2-yl)prop-2-en-1-one (PubChem CID 779814) has the molecular formula C15H13NO2
and a molecular weight of 239.27 g/mol. Its IUPAC name is (E)-1-(2,3-dihydroindol-1-yl)-3-(furan-2-yl)prop-2-en-1-one.
Molecular Properties
| Compound Name | (E)-1-(2,3-dihydroindol-1-yl)-3-(furan-2-yl)prop-2-en-1-one |
| PubChem CID | 779814 |
| Molecular Formula | C15H13NO2 |
| Molecular Weight | 239.27 g/mol |
| Exact Mass | 239.09 |
| IUPAC Name | (E)-1-(2,3-dihydroindol-1-yl)-3-(furan-2-yl)prop-2-en-1-one |
| SMILES | O=C(/C=C/c1ccco1)N1CCc2ccccc21 |
| InChI | InChI=1S/C15H13NO2/c17-15(8-7-13-5-3-11-18-13)16-10-9-12-4-1-2-6-14(12)16/h1-8,11H,9-10H2/b8-7+ |
| InChIKey | XFJDULHCELCQOW-BQYQJAHWSA-N |
| XLogP | 2.88 |
| TPSA | 33.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 239.27 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze (E)-1-(2,3-dihydroindol-1-yl)-3-(furan-2-yl)prop-2-en-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-1-(2,3-dihydroindol-1-yl)-3-(furan-2-yl)prop-2-en-1-one?
The IUPAC name of (E)-1-(2,3-dihydroindol-1-yl)-3-(furan-2-yl)prop-2-en-1-one (CID 779814) is (E)-1-(2,3-dihydroindol-1-yl)-3-(furan-2-yl)prop-2-en-1-one.
What is the SMILES notation for (E)-1-(2,3-dihydroindol-1-yl)-3-(furan-2-yl)prop-2-en-1-one?
The canonical SMILES for (E)-1-(2,3-dihydroindol-1-yl)-3-(furan-2-yl)prop-2-en-1-one is O=C(/C=C/c1ccco1)N1CCc2ccccc21.
What is the InChIKey of (E)-1-(2,3-dihydroindol-1-yl)-3-(furan-2-yl)prop-2-en-1-one?
The InChIKey is XFJDULHCELCQOW-BQYQJAHWSA-N. The full InChI is InChI=1S/C15H13NO2/c17-15(8-7-13-5-3-11-18-13)16-10-9-12-4-1-2-6-14(12)16/h1-8,11H,9-10H2/b8-7+.
What are the key properties of (E)-1-(2,3-dihydroindol-1-yl)-3-(furan-2-yl)prop-2-en-1-one?
(E)-1-(2,3-dihydroindol-1-yl)-3-(furan-2-yl)prop-2-en-1-one has a molecular weight of 239.27 g/mol, XLogP of 2.88, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-1-(2,3-dihydroindol-1-yl)-3-(furan-2-yl)prop-2-en-1-one is sourced from PubChem (CID 779814), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).