C18H16N4O2 — CID 780051
2-(4-nitrophenyl)-4-propylimidazo[1,2-a]benzimidazole (PubChem CID 780051) has the molecular formula C18H16N4O2 and a molecular weight of 320.35 g/mol. Its IUPAC name is 2-(4-nitrophenyl)-4-propylimidazo[1,2-a]benzimidazole.
| Compound Name | 2-(4-nitrophenyl)-4-propylimidazo[1,2-a]benzimidazole |
|---|---|
| PubChem CID | 780051 |
| Molecular Formula | C18H16N4O2 |
| Molecular Weight | 320.35 g/mol |
| Exact Mass | 320.13 |
| IUPAC Name | 2-(4-nitrophenyl)-4-propylimidazo[1,2-a]benzimidazole |
| SMILES | CCCn1c2ccccc2n2cc(-c3ccc([N+](=O)[O-])cc3)nc12 |
| InChI | InChI=1S/C18H16N4O2/c1-2-11-20-16-5-3-4-6-17(16)21-12-15(19-18(20)21)13-7-9-14(10-8-13)22(23)24/h3-10,12H,2,11H2,1H3 |
| InChIKey | YCOFIHYGIRCHDT-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 65.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.35 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|