C38H42N6O5 — CID 78005484
ethyl 4-[2-[3-(azidomethyl)-3,4-dihydro-1H-isoquinoline-2-carbonyl]-4-[(2-methylpropan-2-yl)oxycarbonyl]phenyl]-5-butyl-1-phenylpyrazole-3-carboxylate (PubChem CID 78005484) has the molecular formula C38H42N6O5 and a molecular weight of 662.79 g/mol. Its IUPAC name is ethyl 4-[2-[3-(azidomethyl)-3,4-dihydro-1H-isoquinoline-2-carbonyl]-4-[(2-methylpropan-2-yl)oxycarbonyl]phenyl]-5-butyl-1-phenylpyrazole-3-carboxylate.
| Compound Name | ethyl 4-[2-[3-(azidomethyl)-3,4-dihydro-1H-isoquinoline-2-carbonyl]-4-[(2-methylpropan-2-yl)oxycarbonyl]phenyl]-5-butyl-1-phenylpyrazole-3-carboxylate |
|---|---|
| PubChem CID | 78005484 |
| Molecular Formula | C38H42N6O5 |
| Molecular Weight | 662.79 g/mol |
| Exact Mass | 662.32 |
| IUPAC Name | ethyl 4-[2-[3-(azidomethyl)-3,4-dihydro-1H-isoquinoline-2-carbonyl]-4-[(2-methylpropan-2-yl)oxycarbonyl]phenyl]-5-butyl-1-phenylpyrazole-3-carboxylate |
| SMILES | CCCCc1c(-c2ccc(C(=O)OC(C)(C)C)cc2C(=O)N2Cc3ccccc3CC2CN=[N+]=[N-])c(C(=O)OCC)nn1-c1ccccc1 |
| InChI | InChI=1S/C38H42N6O5/c1-6-8-18-32-33(34(37(47)48-7-2)41-44(32)28-16-10-9-11-17-28)30-20-19-26(36(46)49-38(3,4)5)22-31(30)35(45)43-24-27-15-13-12-14-25(27)21-29(43)23-40-42-39/h9-17,19-20,22,29H,6-8,18,21,23-24H2,1-5H3 |
| InChIKey | BPRQTSZVSKQHKT-UHFFFAOYSA-N |
| XLogP | 7.89 |
| TPSA | 139.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 662.79 |
| LogP ≤ 5 | 7.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|