C16H15BrFNO3S — CID 7801118
[2-(4-bromo-2-fluoroanilino)-2-oxoethyl] 4-ethyl-5-methylthiophene-2-carboxylate (PubChem CID 7801118) has the molecular formula C16H15BrFNO3S and a molecular weight of 400.27 g/mol. Its IUPAC name is [2-(4-bromo-2-fluoroanilino)-2-oxoethyl] 4-ethyl-5-methylthiophene-2-carboxylate.
| Compound Name | [2-(4-bromo-2-fluoroanilino)-2-oxoethyl] 4-ethyl-5-methylthiophene-2-carboxylate |
|---|---|
| PubChem CID | 7801118 |
| Molecular Formula | C16H15BrFNO3S |
| Molecular Weight | 400.27 g/mol |
| Exact Mass | 398.99 |
| IUPAC Name | [2-(4-bromo-2-fluoroanilino)-2-oxoethyl] 4-ethyl-5-methylthiophene-2-carboxylate |
| SMILES | CCc1cc(C(=O)OCC(=O)Nc2ccc(Br)cc2F)sc1C |
| InChI | InChI=1S/C16H15BrFNO3S/c1-3-10-6-14(23-9(10)2)16(21)22-8-15(20)19-13-5-4-11(17)7-12(13)18/h4-7H,3,8H2,1-2H3,(H,19,20) |
| InChIKey | PDMFJYJEFBLCKF-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.27 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |