C21H17F3N2O2 — CID 78018702
benzyl N-[pyridin-2-yl-[4-(trifluoromethyl)phenyl]methyl]carbamate (PubChem CID 78018702) has the molecular formula C21H17F3N2O2 and a molecular weight of 386.37 g/mol. Its IUPAC name is benzyl N-[pyridin-2-yl-[4-(trifluoromethyl)phenyl]methyl]carbamate.
| Compound Name | benzyl N-[pyridin-2-yl-[4-(trifluoromethyl)phenyl]methyl]carbamate |
|---|---|
| PubChem CID | 78018702 |
| Molecular Formula | C21H17F3N2O2 |
| Molecular Weight | 386.37 g/mol |
| Exact Mass | 386.12 |
| IUPAC Name | benzyl N-[pyridin-2-yl-[4-(trifluoromethyl)phenyl]methyl]carbamate |
| SMILES | O=C(NC(c1ccc(C(F)(F)F)cc1)c1ccccn1)OCc1ccccc1 |
| InChI | InChI=1S/C21H17F3N2O2/c22-21(23,24)17-11-9-16(10-12-17)19(18-8-4-5-13-25-18)26-20(27)28-14-15-6-2-1-3-7-15/h1-13,19H,14H2,(H,26,27) |
| InChIKey | ZSWGBRLVJFFZIC-UHFFFAOYSA-N |
| XLogP | 5.12 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.37 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |